C28H46O5 — CID 142246597
7-[8-(4-ethyl-4-methyl-5-oxohexyl)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 142246597) has the molecular formula C28H46O5 and a molecular weight of 462.67 g/mol. Its IUPAC name is 7-[8-(4-ethyl-4-methyl-5-oxohexyl)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | 7-[8-(4-ethyl-4-methyl-5-oxohexyl)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 142246597 |
| Molecular Formula | C28H46O5 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | 7-[8-(4-ethyl-4-methyl-5-oxohexyl)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | CCC(C)(CCCC1CC(C)C=C2C=CC(C)C(CCC(O)CC(O)CC(=O)O)C21)C(C)=O |
| InChI | InChI=1S/C28H46O5/c1-6-28(5,20(4)29)13-7-8-21-14-18(2)15-22-10-9-19(3)25(27(21)22)12-11-23(30)16-24(31)17-26(32)33/h9-10,15,18-19,21,23-25,27,30-31H,6-8,11-14,16-17H2,1-5H3,(H,32,33) |
| InChIKey | LZWFUALHLYXJOX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |