C11H22N2O — CID 142250726
3-[2-[methyl-[(3Z)-penta-1,3-dien-2-yl]amino]ethylamino]propan-1-ol (PubChem CID 142250726) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-[2-[methyl-[(3Z)-penta-1,3-dien-2-yl]amino]ethylamino]propan-1-ol.
| Compound Name | 3-[2-[methyl-[(3Z)-penta-1,3-dien-2-yl]amino]ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 142250726 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 3-[2-[methyl-[(3Z)-penta-1,3-dien-2-yl]amino]ethylamino]propan-1-ol |
| SMILES | C=C(/C=C\C)N(C)CCNCCCO |
| InChI | InChI=1S/C11H22N2O/c1-4-6-11(2)13(3)9-8-12-7-5-10-14/h4,6,12,14H,2,5,7-10H2,1,3H3/b6-4- |
| InChIKey | ODQJXDGRUAUYJO-XQRVVYSFSA-N |
| XLogP | 0.98 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|