C30H40Cl2N4O — CID 142251359
benzonitrile;3-(3,5-dichlorophenyl)-1-[2-[ethyl(pentyl)amino]ethyl]-1-(6-methyl-2-bicyclo[3.1.0]hexanyl)urea (PubChem CID 142251359) has the molecular formula C30H40Cl2N4O and a molecular weight of 543.58 g/mol. Its IUPAC name is benzonitrile;3-(3,5-dichlorophenyl)-1-[2-[ethyl(pentyl)amino]ethyl]-1-(6-methyl-2-bicyclo[3.1.0]hexanyl)urea.
| Compound Name | benzonitrile;3-(3,5-dichlorophenyl)-1-[2-[ethyl(pentyl)amino]ethyl]-1-(6-methyl-2-bicyclo[3.1.0]hexanyl)urea |
|---|---|
| PubChem CID | 142251359 |
| Molecular Formula | C30H40Cl2N4O |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | benzonitrile;3-(3,5-dichlorophenyl)-1-[2-[ethyl(pentyl)amino]ethyl]-1-(6-methyl-2-bicyclo[3.1.0]hexanyl)urea |
| SMILES | CCCCCN(CC)CCN(C(=O)Nc1cc(Cl)cc(Cl)c1)C1CCC2C(C)C21.N#Cc1ccccc1 |
| InChI | InChI=1S/C23H35Cl2N3O.C7H5N/c1-4-6-7-10-27(5-2)11-12-28(21-9-8-20-16(3)22(20)21)23(29)26-19-14-17(24)13-18(25)15-19;8-6-7-4-2-1-3-5-7/h13-16,20-22H,4-12H2,1-3H3,(H,26,29);1-5H |
| InChIKey | ICTNZJQWLOEFPF-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|