C10H14F3N — CID 142253956
3-(difluoromethyl)-3,5-dimethylazepine;fluoromethane (PubChem CID 142253956) has the molecular formula C10H14F3N and a molecular weight of 205.22 g/mol. Its IUPAC name is 3-(difluoromethyl)-3,5-dimethylazepine;fluoromethane.
| Compound Name | 3-(difluoromethyl)-3,5-dimethylazepine;fluoromethane |
|---|---|
| PubChem CID | 142253956 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3-(difluoromethyl)-3,5-dimethylazepine;fluoromethane |
| SMILES | CC1=CC(C)(C(F)F)C=NC=C1.CF |
| InChI | InChI=1S/C9H11F2N.CH3F/c1-7-3-4-12-6-9(2,5-7)8(10)11;1-2/h3-6,8H,1-2H3;1H3 |
| InChIKey | ZKPMXMJSULRAHJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |