C11H19NS — CID 142256802
ethane;2-methyl-3,4,7,8-tetrahydro-2H-cyclohepta[d][1,3]thiazole (PubChem CID 142256802) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is ethane;2-methyl-3,4,7,8-tetrahydro-2H-cyclohepta[d][1,3]thiazole.
| Compound Name | ethane;2-methyl-3,4,7,8-tetrahydro-2H-cyclohepta[d][1,3]thiazole |
|---|---|
| PubChem CID | 142256802 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | ethane;2-methyl-3,4,7,8-tetrahydro-2H-cyclohepta[d][1,3]thiazole |
| SMILES | CC.CC1NC2=C(CCC=CC2)S1 |
| InChI | InChI=1S/C9H13NS.C2H6/c1-7-10-8-5-3-2-4-6-9(8)11-7;1-2/h2-3,7,10H,4-6H2,1H3;1-2H3 |
| InChIKey | FGSUNGHVHLGTMN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|