C11H21NS — CID 6447468
2-[(E)-hept-3-enyl]-2-methyl-1,3-thiazolidine (PubChem CID 6447468) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is 2-[(E)-hept-3-enyl]-2-methyl-1,3-thiazolidine.
| Compound Name | 2-[(E)-hept-3-enyl]-2-methyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 6447468 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 2-[(E)-hept-3-enyl]-2-methyl-1,3-thiazolidine |
| SMILES | CCC/C=C/CCC1(C)NCCS1 |
| InChI | InChI=1S/C11H21NS/c1-3-4-5-6-7-8-11(2)12-9-10-13-11/h5-6,12H,3-4,7-10H2,1-2H3/b6-5+ |
| InChIKey | VPGMNFFANPOGGC-AATRIKPKSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|