C8H15NS — CID 3058778
2-but-3-enyl-2-methyl-1,3-thiazolidine (PubChem CID 3058778) has the molecular formula C8H15NS and a molecular weight of 157.28 g/mol. Its IUPAC name is 2-but-3-enyl-2-methyl-1,3-thiazolidine.
| Compound Name | 2-but-3-enyl-2-methyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 3058778 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2-but-3-enyl-2-methyl-1,3-thiazolidine |
| SMILES | C=CCCC1(C)NCCS1 |
| InChI | InChI=1S/C8H15NS/c1-3-4-5-8(2)9-6-7-10-8/h3,9H,1,4-7H2,2H3 |
| InChIKey | SIHPZJOASJTCEC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|