C10H17NS — CID 6447467
2-[(3E)-hexa-3,5-dienyl]-2-methyl-1,3-thiazolidine (PubChem CID 6447467) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is 2-[(3E)-hexa-3,5-dienyl]-2-methyl-1,3-thiazolidine.
| Compound Name | 2-[(3E)-hexa-3,5-dienyl]-2-methyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 6447467 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-[(3E)-hexa-3,5-dienyl]-2-methyl-1,3-thiazolidine |
| SMILES | C=C/C=C/CCC1(C)NCCS1 |
| InChI | InChI=1S/C10H17NS/c1-3-4-5-6-7-10(2)11-8-9-12-10/h3-5,11H,1,6-9H2,2H3/b5-4+ |
| InChIKey | VBANYWLSKUFJFP-SNAWJCMRSA-N |
| XLogP | 2.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|