C9H15NS — CID 3058789
2-methyl-2-penta-3,4-dienyl-1,3-thiazolidine (PubChem CID 3058789) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is 2-methyl-2-penta-3,4-dienyl-1,3-thiazolidine.
| Compound Name | 2-methyl-2-penta-3,4-dienyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 3058789 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2-methyl-2-penta-3,4-dienyl-1,3-thiazolidine |
| SMILES | C=C=CCCC1(C)NCCS1 |
| InChI | InChI=1S/C9H15NS/c1-3-4-5-6-9(2)10-7-8-11-9/h4,10H,1,5-8H2,2H3 |
| InChIKey | QACMFMCVAMDINW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |