C9H17NS — CID 3058781
2-methyl-2-(3-methylbut-3-enyl)-1,3-thiazolidine (PubChem CID 3058781) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is 2-methyl-2-(3-methylbut-3-enyl)-1,3-thiazolidine.
| Compound Name | 2-methyl-2-(3-methylbut-3-enyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 3058781 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 2-methyl-2-(3-methylbut-3-enyl)-1,3-thiazolidine |
| SMILES | C=C(C)CCC1(C)NCCS1 |
| InChI | InChI=1S/C9H17NS/c1-8(2)4-5-9(3)10-6-7-11-9/h10H,1,4-7H2,2-3H3 |
| InChIKey | MIIKFNWDNMFFNV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|