C18H39NO — CID 142257081
8-amino-2,2,5,5,6,6,9,9-octamethyldecan-4-ol (PubChem CID 142257081) has the molecular formula C18H39NO and a molecular weight of 285.52 g/mol. Its IUPAC name is 8-amino-2,2,5,5,6,6,9,9-octamethyldecan-4-ol.
| Compound Name | 8-amino-2,2,5,5,6,6,9,9-octamethyldecan-4-ol |
|---|---|
| PubChem CID | 142257081 |
| Molecular Formula | C18H39NO |
| Molecular Weight | 285.52 g/mol |
| Exact Mass | 285.30 |
| IUPAC Name | 8-amino-2,2,5,5,6,6,9,9-octamethyldecan-4-ol |
| SMILES | CC(C)(C)CC(O)C(C)(C)C(C)(C)CC(N)C(C)(C)C |
| InChI | InChI=1S/C18H39NO/c1-15(2,3)12-14(20)18(9,10)17(7,8)11-13(19)16(4,5)6/h13-14,20H,11-12,19H2,1-10H3 |
| InChIKey | ZLEFMQWBDNQSJV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |