C12H26O3 — CID 87646657
2,2,7,7-tetramethyloctane-4,4,5-triol (PubChem CID 87646657) has the molecular formula C12H26O3 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2,2,7,7-tetramethyloctane-4,4,5-triol.
| Compound Name | 2,2,7,7-tetramethyloctane-4,4,5-triol |
|---|---|
| PubChem CID | 87646657 |
| Molecular Formula | C12H26O3 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | 2,2,7,7-tetramethyloctane-4,4,5-triol |
| SMILES | CC(C)(C)CC(O)C(O)(O)CC(C)(C)C |
| InChI | InChI=1S/C12H26O3/c1-10(2,3)7-9(13)12(14,15)8-11(4,5)6/h9,13-15H,7-8H2,1-6H3 |
| InChIKey | VIGOYXXTKSNPOF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|