C7H10N2O — CID 142257812
(3Z)-3-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol (PubChem CID 142257812) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is (3Z)-3-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol.
| Compound Name | (3Z)-3-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 142257812 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (3Z)-3-[(E)-hydrazinylidenemethyl]hexa-1,3,5-trien-2-ol |
| SMILES | C=C/C=C(/C=N/N)C(=C)O |
| InChI | InChI=1S/C7H10N2O/c1-3-4-7(5-9-8)6(2)10/h3-5,10H,1-2,8H2/b7-4-,9-5+ |
| InChIKey | IYGOZIHVZPVJEH-ICDOWURLSA-N |
| XLogP | 1.12 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|