C7H9NO2 — CID 143182820
(3Z)-3-methanimidoylhexa-1,3,5-triene-2,5-diol (PubChem CID 143182820) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is (3Z)-3-methanimidoylhexa-1,3,5-triene-2,5-diol.
| Compound Name | (3Z)-3-methanimidoylhexa-1,3,5-triene-2,5-diol |
|---|---|
| PubChem CID | 143182820 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (3Z)-3-methanimidoylhexa-1,3,5-triene-2,5-diol |
| SMILES | [H]/N=C/C(=C/C(=C)O)C(=C)O |
| InChI | InChI=1S/C7H9NO2/c1-5(9)3-7(4-8)6(2)10/h3-4,8-10H,1-2H2/b7-3-,8-4+ |
| InChIKey | GLWYXMNVTTYAMM-KYPMKJFLSA-N |
| XLogP | 1.71 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|