C11H11NO — CID 177021081
(3Z)-4-imino-3-(6-methylidenecyclohexa-2,4-dien-1-ylidene)but-1-en-2-ol (PubChem CID 177021081) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is (3Z)-4-imino-3-(6-methylidenecyclohexa-2,4-dien-1-ylidene)but-1-en-2-ol.
| Compound Name | (3Z)-4-imino-3-(6-methylidenecyclohexa-2,4-dien-1-ylidene)but-1-en-2-ol |
|---|---|
| PubChem CID | 177021081 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | (3Z)-4-imino-3-(6-methylidenecyclohexa-2,4-dien-1-ylidene)but-1-en-2-ol |
| SMILES | [H]/N=C/C(C(=C)O)=c1\ccccc1=C |
| InChI | InChI=1S/C11H11NO/c1-8-5-3-4-6-10(8)11(7-12)9(2)13/h3-7,12-13H,1-2H2/b11-10-,12-7+ |
| InChIKey | VSNMUOBPEIRWFV-LVILPVEGSA-N |
| XLogP | 0.97 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|