C7H9NO — CID 145386438
(3Z)-3-methanimidoylhexa-1,3,5-trien-2-ol (PubChem CID 145386438) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is (3Z)-3-methanimidoylhexa-1,3,5-trien-2-ol.
| Compound Name | (3Z)-3-methanimidoylhexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 145386438 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | (3Z)-3-methanimidoylhexa-1,3,5-trien-2-ol |
| SMILES | [H]/N=C/C(=C/C=C)C(=C)O |
| InChI | InChI=1S/C7H9NO/c1-3-4-7(5-8)6(2)9/h3-5,8-9H,1-2H2/b7-4-,8-5+ |
| InChIKey | YRWWFEQOMYIDNK-DKBJKEKUSA-N |
| XLogP | 1.82 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|