C21H27N9O2 — CID 142258249
2-[[5-[amino-(hydroxyamino)methyl]-1-(3-methylbutyl)benzimidazol-2-yl]methyl]-N'-hydroxybenzotriazole-5-carboximidamide (PubChem CID 142258249) has the molecular formula C21H27N9O2 and a molecular weight of 437.51 g/mol. Its IUPAC name is 2-[[5-[amino-(hydroxyamino)methyl]-1-(3-methylbutyl)benzimidazol-2-yl]methyl]-N'-hydroxybenzotriazole-5-carboximidamide.
| Compound Name | 2-[[5-[amino-(hydroxyamino)methyl]-1-(3-methylbutyl)benzimidazol-2-yl]methyl]-N'-hydroxybenzotriazole-5-carboximidamide |
|---|---|
| PubChem CID | 142258249 |
| Molecular Formula | C21H27N9O2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2-[[5-[amino-(hydroxyamino)methyl]-1-(3-methylbutyl)benzimidazol-2-yl]methyl]-N'-hydroxybenzotriazole-5-carboximidamide |
| SMILES | CC(C)CCn1c(Cn2nc3ccc(/C(N)=N/O)cc3n2)nc2cc(C(N)NO)ccc21 |
| InChI | InChI=1S/C21H27N9O2/c1-12(2)7-8-29-18-6-4-14(21(23)28-32)10-17(18)24-19(29)11-30-25-15-5-3-13(20(22)27-31)9-16(15)26-30/h3-6,9-10,12,21,28,31-32H,7-8,11,23H2,1-2H3,(H2,22,27) |
| InChIKey | SQSXPGAAIGUUOM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 165.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|