C12H15N3O2 — CID 142260902
5-(2,5-dimethyl-1H-pyrrol-3-yl)-2,4-dimethoxypyrimidine (PubChem CID 142260902) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 5-(2,5-dimethyl-1H-pyrrol-3-yl)-2,4-dimethoxypyrimidine.
| Compound Name | 5-(2,5-dimethyl-1H-pyrrol-3-yl)-2,4-dimethoxypyrimidine |
|---|---|
| PubChem CID | 142260902 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 5-(2,5-dimethyl-1H-pyrrol-3-yl)-2,4-dimethoxypyrimidine |
| SMILES | COc1ncc(-c2cc(C)[nH]c2C)c(OC)n1 |
| InChI | InChI=1S/C12H15N3O2/c1-7-5-9(8(2)14-7)10-6-13-12(17-4)15-11(10)16-3/h5-6,14H,1-4H3 |
| InChIKey | WPAKANLOIPWKNL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |