C13H18N2O2S — CID 142261062
1-(2-oxo-3,4-dihydro-1H-2λ4,1,3-benzothiadiazin-6-yl)hexan-1-one (PubChem CID 142261062) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 1-(2-oxo-3,4-dihydro-1H-2λ4,1,3-benzothiadiazin-6-yl)hexan-1-one.
| Compound Name | 1-(2-oxo-3,4-dihydro-1H-2λ4,1,3-benzothiadiazin-6-yl)hexan-1-one |
|---|---|
| PubChem CID | 142261062 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-(2-oxo-3,4-dihydro-1H-2λ4,1,3-benzothiadiazin-6-yl)hexan-1-one |
| SMILES | CCCCCC(=O)c1ccc2c(c1)CNS(=O)N2 |
| InChI | InChI=1S/C13H18N2O2S/c1-2-3-4-5-13(16)10-6-7-12-11(8-10)9-14-18(17)15-12/h6-8,14-15H,2-5,9H2,1H3 |
| InChIKey | XOVJUDJOQCZFRD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|