C23H24O — CID 142263248
ethane;3-ethenyl-2,5-diphenyl-4-[(Z)-prop-1-enyl]furan (PubChem CID 142263248) has the molecular formula C23H24O and a molecular weight of 316.44 g/mol. Its IUPAC name is ethane;3-ethenyl-2,5-diphenyl-4-[(Z)-prop-1-enyl]furan.
| Compound Name | ethane;3-ethenyl-2,5-diphenyl-4-[(Z)-prop-1-enyl]furan |
|---|---|
| PubChem CID | 142263248 |
| Molecular Formula | C23H24O |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | ethane;3-ethenyl-2,5-diphenyl-4-[(Z)-prop-1-enyl]furan |
| SMILES | C=Cc1c(-c2ccccc2)oc(-c2ccccc2)c1/C=C\C.CC |
| InChI | InChI=1S/C21H18O.C2H6/c1-3-11-19-18(4-2)20(16-12-7-5-8-13-16)22-21(19)17-14-9-6-10-15-17;1-2/h3-15H,2H2,1H3;1-2H3/b11-3-; |
| InChIKey | YILGCBJRWFFMED-PHXMKGPASA-N |
| XLogP | 7.32 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |