C19H37N — CID 142264899
ethane;4-methyl-4-propan-2-yl-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]piperidine (PubChem CID 142264899) has the molecular formula C19H37N and a molecular weight of 279.51 g/mol. Its IUPAC name is ethane;4-methyl-4-propan-2-yl-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]piperidine.
| Compound Name | ethane;4-methyl-4-propan-2-yl-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]piperidine |
|---|---|
| PubChem CID | 142264899 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | ethane;4-methyl-4-propan-2-yl-1-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]piperidine |
| SMILES | C/C=C\C(=C/CC)CN1CCC(C)(C(C)C)CC1.CC |
| InChI | InChI=1S/C17H31N.C2H6/c1-6-8-16(9-7-2)14-18-12-10-17(5,11-13-18)15(3)4;1-2/h6,8-9,15H,7,10-14H2,1-5H3;1-2H3/b8-6-,16-9+; |
| InChIKey | OYIVKFASAYFQRV-XGVFMHGISA-N |
| XLogP | 5.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|