C21H39N — CID 69050179
1-[(2E,6E)-9,9,11,11-tetramethyldodeca-2,6-dienyl]piperidine (PubChem CID 69050179) has the molecular formula C21H39N and a molecular weight of 305.55 g/mol. Its IUPAC name is 1-[(2E,6E)-9,9,11,11-tetramethyldodeca-2,6-dienyl]piperidine.
| Compound Name | 1-[(2E,6E)-9,9,11,11-tetramethyldodeca-2,6-dienyl]piperidine |
|---|---|
| PubChem CID | 69050179 |
| Molecular Formula | C21H39N |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 305.31 |
| IUPAC Name | 1-[(2E,6E)-9,9,11,11-tetramethyldodeca-2,6-dienyl]piperidine |
| SMILES | CC(C)(C)CC(C)(C)C/C=C/CC/C=C/CN1CCCCC1 |
| InChI | InChI=1S/C21H39N/c1-20(2,3)19-21(4,5)15-11-8-6-7-9-12-16-22-17-13-10-14-18-22/h8-9,11-12H,6-7,10,13-19H2,1-5H3/b11-8+,12-9+ |
| InChIKey | YIESDTAXSVLCPA-HZOWPXDZSA-N |
| XLogP | 6.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|