C16H15NO2 — CID 142265668
(1R,10aS)-1-methyl-2,6-dioxo-1,4a,8a,9,10,10a-hexahydrophenanthrene-3-carbonitrile (PubChem CID 142265668) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is (1R,10aS)-1-methyl-2,6-dioxo-1,4a,8a,9,10,10a-hexahydrophenanthrene-3-carbonitrile.
| Compound Name | (1R,10aS)-1-methyl-2,6-dioxo-1,4a,8a,9,10,10a-hexahydrophenanthrene-3-carbonitrile |
|---|---|
| PubChem CID | 142265668 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (1R,10aS)-1-methyl-2,6-dioxo-1,4a,8a,9,10,10a-hexahydrophenanthrene-3-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=CC2C3=CC(=O)C=CC3CC[C@@H]21 |
| InChI | InChI=1S/C16H15NO2/c1-9-13-5-3-10-2-4-12(18)7-14(10)15(13)6-11(8-17)16(9)19/h2,4,6-7,9-10,13,15H,3,5H2,1H3/t9-,10?,13-,15?/m1/s1 |
| InChIKey | DPLZFXFXSCDQKD-RSSUCFIBSA-N |
| XLogP | 2.36 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |