C30H37N5O2S2 — CID 142265958
N'-[(Z)-1-[4-(diethylamino)phenyl]-2-sulfanylethenyl]-N-[4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]methanimidamide (PubChem CID 142265958) has the molecular formula C30H37N5O2S2 and a molecular weight of 563.79 g/mol. Its IUPAC name is N'-[(Z)-1-[4-(diethylamino)phenyl]-2-sulfanylethenyl]-N-[4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]methanimidamide.
| Compound Name | N'-[(Z)-1-[4-(diethylamino)phenyl]-2-sulfanylethenyl]-N-[4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]methanimidamide |
|---|---|
| PubChem CID | 142265958 |
| Molecular Formula | C30H37N5O2S2 |
| Molecular Weight | 563.79 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | N'-[(Z)-1-[4-(diethylamino)phenyl]-2-sulfanylethenyl]-N-[4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]methanimidamide |
| SMILES | CCN(CC)c1ccc(C(=C/S)/N=C/Nc2ccc(N3CCN(S(=O)(=O)c4ccc(C)cc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H37N5O2S2/c1-4-33(5-2)27-12-8-25(9-13-27)30(22-38)32-23-31-26-10-14-28(15-11-26)34-18-20-35(21-19-34)39(36,37)29-16-6-24(3)7-17-29/h6-17,22-23,38H,4-5,18-21H2,1-3H3,(H,31,32)/b30-22- |
| InChIKey | IDOLGHHFOWLSCX-SWKFRHMKSA-N |
| XLogP | 5.72 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.79 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|