C20H21N3O2S — CID 142266117
N-(1,3-benzodioxol-5-yl)-N'-[(Z)-1-(4-pyrrolidin-1-ylphenyl)-2-sulfanylethenyl]methanimidamide (PubChem CID 142266117) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N'-[(Z)-1-(4-pyrrolidin-1-ylphenyl)-2-sulfanylethenyl]methanimidamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N'-[(Z)-1-(4-pyrrolidin-1-ylphenyl)-2-sulfanylethenyl]methanimidamide |
|---|---|
| PubChem CID | 142266117 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N'-[(Z)-1-(4-pyrrolidin-1-ylphenyl)-2-sulfanylethenyl]methanimidamide |
| SMILES | S/C=C(\N=C\Nc1ccc2c(c1)OCO2)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c26-12-18(15-3-6-17(7-4-15)23-9-1-2-10-23)22-13-21-16-5-8-19-20(11-16)25-14-24-19/h3-8,11-13,26H,1-2,9-10,14H2,(H,21,22)/b18-12- |
| InChIKey | UABBHRBUCGZWRL-PDGQHHTCSA-N |
| XLogP | 4.38 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|