C24H33N5S — CID 142265971
N'-[(Z)-1-[4-(diethylamino)phenyl]-2-sulfanylethenyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]methanimidamide (PubChem CID 142265971) has the molecular formula C24H33N5S and a molecular weight of 423.63 g/mol. Its IUPAC name is N'-[(Z)-1-[4-(diethylamino)phenyl]-2-sulfanylethenyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]methanimidamide.
| Compound Name | N'-[(Z)-1-[4-(diethylamino)phenyl]-2-sulfanylethenyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]methanimidamide |
|---|---|
| PubChem CID | 142265971 |
| Molecular Formula | C24H33N5S |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | N'-[(Z)-1-[4-(diethylamino)phenyl]-2-sulfanylethenyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]methanimidamide |
| SMILES | CCN(CC)c1ccc(C(=C/S)/N=C/Nc2ccc(N3CCN(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C24H33N5S/c1-4-28(5-2)22-10-6-20(7-11-22)24(18-30)26-19-25-21-8-12-23(13-9-21)29-16-14-27(3)15-17-29/h6-13,18-19,30H,4-5,14-17H2,1-3H3,(H,25,26)/b24-18- |
| InChIKey | KYMVOPZXKTVETG-MOHJPFBDSA-N |
| XLogP | 4.65 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|