C27H36N4 — CID 175696795
N,N-diethyl-4-[2-[1-methyl-7-(4-methylpiperazin-1-yl)-2H-quinolin-2-yl]ethenyl]aniline (PubChem CID 175696795) has the molecular formula C27H36N4 and a molecular weight of 416.61 g/mol. Its IUPAC name is N,N-diethyl-4-[2-[1-methyl-7-(4-methylpiperazin-1-yl)-2H-quinolin-2-yl]ethenyl]aniline.
| Compound Name | N,N-diethyl-4-[2-[1-methyl-7-(4-methylpiperazin-1-yl)-2H-quinolin-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 175696795 |
| Molecular Formula | C27H36N4 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | N,N-diethyl-4-[2-[1-methyl-7-(4-methylpiperazin-1-yl)-2H-quinolin-2-yl]ethenyl]aniline |
| SMILES | CCN(CC)c1ccc(C=CC2C=Cc3ccc(N4CCN(C)CC4)cc3N2C)cc1 |
| InChI | InChI=1S/C27H36N4/c1-5-30(6-2)25-13-8-22(9-14-25)7-12-24-15-10-23-11-16-26(21-27(23)29(24)4)31-19-17-28(3)18-20-31/h7-16,21,24H,5-6,17-20H2,1-4H3 |
| InChIKey | CQBXYKZTQRWMNI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|