C25H31N3O — CID 70424229
N,N-diethyl-4-[2-[3-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1,3-dihydropyrazol-5-yl]ethenyl]aniline (PubChem CID 70424229) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is N,N-diethyl-4-[2-[3-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1,3-dihydropyrazol-5-yl]ethenyl]aniline.
| Compound Name | N,N-diethyl-4-[2-[3-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1,3-dihydropyrazol-5-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 70424229 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | N,N-diethyl-4-[2-[3-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1,3-dihydropyrazol-5-yl]ethenyl]aniline |
| SMILES | CCN(CC)c1ccc(C=CC2=CC(C=Cc3ccc(OC)cc3)N(C)N2)cc1 |
| InChI | InChI=1S/C25H31N3O/c1-5-28(6-2)23-14-8-20(9-15-23)7-13-22-19-24(27(3)26-22)16-10-21-11-17-25(29-4)18-12-21/h7-19,24,26H,5-6H2,1-4H3 |
| InChIKey | CIPQAGPTCOUVRH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|