C11H8N2O2 — CID 142272085
(Z)-3-(2-oxo-3,5-dihydrocyclohepta[d][1,3]oxazol-7-yl)prop-2-enenitrile (PubChem CID 142272085) has the molecular formula C11H8N2O2 and a molecular weight of 200.20 g/mol. Its IUPAC name is (Z)-3-(2-oxo-3,5-dihydrocyclohepta[d][1,3]oxazol-7-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(2-oxo-3,5-dihydrocyclohepta[d][1,3]oxazol-7-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 142272085 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (Z)-3-(2-oxo-3,5-dihydrocyclohepta[d][1,3]oxazol-7-yl)prop-2-enenitrile |
| SMILES | N#C/C=C\C1=CCC=c2[nH]c(=O)oc2=C1 |
| InChI | InChI=1S/C11H8N2O2/c12-6-2-4-8-3-1-5-9-10(7-8)15-11(14)13-9/h2-5,7H,1H2,(H,13,14)/b4-2- |
| InChIKey | GNQWEBKORGQXDB-RQOWECAXSA-N |
| XLogP | -0.06 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|