C11H15NO6SSi — CID 14227369
(5-methoxy-4-nitro-3,3-dioxo-1,3lambda6-benzoxathiol-7-yl)-trimethylsilane (PubChem CID 14227369) has the molecular formula C11H15NO6SSi and a molecular weight of 317.40 g/mol. Its IUPAC name is (5-methoxy-4-nitro-3,3-dioxo-1,3lambda6-benzoxathiol-7-yl)-trimethylsilane.
| Compound Name | (5-methoxy-4-nitro-3,3-dioxo-1,3lambda6-benzoxathiol-7-yl)-trimethylsilane |
|---|---|
| PubChem CID | 14227369 |
| Molecular Formula | C11H15NO6SSi |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | (5-methoxy-4-nitro-3,3-dioxo-1,3lambda6-benzoxathiol-7-yl)-trimethylsilane |
| SMILES | COc1cc([Si](C)(C)C)c2c(c1[N+](=O)[O-])S(=O)(=O)CO2 |
| InChI | InChI=1S/C11H15NO6SSi/c1-17-7-5-8(20(2,3)4)10-11(9(7)12(13)14)19(15,16)6-18-10/h5H,6H2,1-4H3 |
| InChIKey | CAWOVXVRUHIMOH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|