About 3,6-diaminohexan-2-one;ethane
3,6-diaminohexan-2-one;ethane (PubChem CID 142274361) has the molecular formula C8H20N2O
and a molecular weight of 160.26 g/mol. Its IUPAC name is 3,6-diaminohexan-2-one;ethane.
Molecular Properties
| Compound Name | 3,6-diaminohexan-2-one;ethane |
| PubChem CID | 142274361 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | 3,6-diaminohexan-2-one;ethane |
| SMILES | CC.CC(=O)C(N)CCCN |
| InChI | InChI=1S/C6H14N2O.C2H6/c1-5(9)6(8)3-2-4-7;1-2/h6H,2-4,7-8H2,1H3;1-2H3 |
| InChIKey | NMHWVOJTLDGXQB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-diaminohexan-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diaminohexan-2-one;ethane?
The IUPAC name of 3,6-diaminohexan-2-one;ethane (CID 142274361) is 3,6-diaminohexan-2-one;ethane.
What is the SMILES notation for 3,6-diaminohexan-2-one;ethane?
The canonical SMILES for 3,6-diaminohexan-2-one;ethane is CC.CC(=O)C(N)CCCN.
What is the InChIKey of 3,6-diaminohexan-2-one;ethane?
The InChIKey is NMHWVOJTLDGXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O.C2H6/c1-5(9)6(8)3-2-4-7;1-2/h6H,2-4,7-8H2,1H3;1-2H3.
What are the key properties of 3,6-diaminohexan-2-one;ethane?
3,6-diaminohexan-2-one;ethane has a molecular weight of 160.26 g/mol, XLogP of 0.67, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diaminohexan-2-one;ethane is sourced from PubChem (CID 142274361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).