C15H25NO3 — CID 142274377
(6Z,8Z)-9-(3-aminopropoxy)-8-hydroxy-2-methyl-5-methylidenedeca-6,8-dienal (PubChem CID 142274377) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (6Z,8Z)-9-(3-aminopropoxy)-8-hydroxy-2-methyl-5-methylidenedeca-6,8-dienal.
| Compound Name | (6Z,8Z)-9-(3-aminopropoxy)-8-hydroxy-2-methyl-5-methylidenedeca-6,8-dienal |
|---|---|
| PubChem CID | 142274377 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (6Z,8Z)-9-(3-aminopropoxy)-8-hydroxy-2-methyl-5-methylidenedeca-6,8-dienal |
| SMILES | C=C(/C=C\C(O)=C(/C)OCCCN)CCC(C)C=O |
| InChI | InChI=1S/C15H25NO3/c1-12(5-6-13(2)11-17)7-8-15(18)14(3)19-10-4-9-16/h7-8,11,13,18H,1,4-6,9-10,16H2,2-3H3/b8-7-,15-14- |
| InChIKey | IJXMQVSPZIGPPB-XWUSKMMESA-N |
| XLogP | 2.87 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|