C11H19NO3 — CID 174314739
(5Z,7Z)-1-amino-8-methoxy-4-methylidenenona-5,7-diene-2,7-diol (PubChem CID 174314739) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (5Z,7Z)-1-amino-8-methoxy-4-methylidenenona-5,7-diene-2,7-diol.
| Compound Name | (5Z,7Z)-1-amino-8-methoxy-4-methylidenenona-5,7-diene-2,7-diol |
|---|---|
| PubChem CID | 174314739 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (5Z,7Z)-1-amino-8-methoxy-4-methylidenenona-5,7-diene-2,7-diol |
| SMILES | C=C(/C=C\C(O)=C(/C)OC)CC(O)CN |
| InChI | InChI=1S/C11H19NO3/c1-8(6-10(13)7-12)4-5-11(14)9(2)15-3/h4-5,10,13-14H,1,6-7,12H2,2-3H3/b5-4-,11-9- |
| InChIKey | PXOZKCUFPJDAOW-JXWPTCDWSA-N |
| XLogP | 1.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|