C12H22N2 — CID 142275826
1-[(Z,2E)-2-ethylidenepent-3-enyl]-4-methylpiperazine (PubChem CID 142275826) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-[(Z,2E)-2-ethylidenepent-3-enyl]-4-methylpiperazine.
| Compound Name | 1-[(Z,2E)-2-ethylidenepent-3-enyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 142275826 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-[(Z,2E)-2-ethylidenepent-3-enyl]-4-methylpiperazine |
| SMILES | C/C=C\C(=C/C)CN1CCN(C)CC1 |
| InChI | InChI=1S/C12H22N2/c1-4-6-12(5-2)11-14-9-7-13(3)8-10-14/h4-6H,7-11H2,1-3H3/b6-4-,12-5+ |
| InChIKey | ARLRRTRMXCLDRY-GLNLJRCCSA-N |
| XLogP | 1.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|