C38H32N2O2 — CID 142280817
4-(1,8-dimethylcarbazol-9-yl)-2-(4-phenylphenyl)isoindole-1,3-dione;2-methylprop-1-ene (PubChem CID 142280817) has the molecular formula C38H32N2O2 and a molecular weight of 548.69 g/mol. Its IUPAC name is 4-(1,8-dimethylcarbazol-9-yl)-2-(4-phenylphenyl)isoindole-1,3-dione;2-methylprop-1-ene.
| Compound Name | 4-(1,8-dimethylcarbazol-9-yl)-2-(4-phenylphenyl)isoindole-1,3-dione;2-methylprop-1-ene |
|---|---|
| PubChem CID | 142280817 |
| Molecular Formula | C38H32N2O2 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 4-(1,8-dimethylcarbazol-9-yl)-2-(4-phenylphenyl)isoindole-1,3-dione;2-methylprop-1-ene |
| SMILES | C=C(C)C.Cc1cccc2c3cccc(C)c3n(-c3cccc4c3C(=O)N(c3ccc(-c5ccccc5)cc3)C4=O)c12 |
| InChI | InChI=1S/C34H24N2O2.C4H8/c1-21-9-6-13-26-27-14-7-10-22(2)32(27)36(31(21)26)29-16-8-15-28-30(29)34(38)35(33(28)37)25-19-17-24(18-20-25)23-11-4-3-5-12-23;1-4(2)3/h3-20H,1-2H3;1H2,2-3H3 |
| InChIKey | BXPPOECQDJYYAH-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|