C35H50O7 — CID 142281392
[2-heptyl-4-[4-[3-heptyl-4-(trioxidanyl)phenyl]cyclohexyl]phenyl] 2-hydroxyprop-2-eneperoxoate (PubChem CID 142281392) has the molecular formula C35H50O7 and a molecular weight of 582.78 g/mol. Its IUPAC name is [2-heptyl-4-[4-[3-heptyl-4-(trioxidanyl)phenyl]cyclohexyl]phenyl] 2-hydroxyprop-2-eneperoxoate.
| Compound Name | [2-heptyl-4-[4-[3-heptyl-4-(trioxidanyl)phenyl]cyclohexyl]phenyl] 2-hydroxyprop-2-eneperoxoate |
|---|---|
| PubChem CID | 142281392 |
| Molecular Formula | C35H50O7 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | [2-heptyl-4-[4-[3-heptyl-4-(trioxidanyl)phenyl]cyclohexyl]phenyl] 2-hydroxyprop-2-eneperoxoate |
| SMILES | C=C(O)C(=O)OOc1ccc(C2CCC(c3ccc(OOO)c(CCCCCCC)c3)CC2)cc1CCCCCCC |
| InChI | InChI=1S/C35H50O7/c1-4-6-8-10-12-14-31-24-29(20-22-33(31)39-41-35(37)26(3)36)27-16-18-28(19-17-27)30-21-23-34(40-42-38)32(25-30)15-13-11-9-7-5-2/h20-25,27-28,36,38H,3-19H2,1-2H3 |
| InChIKey | HVLGAFMVKGNLMV-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|