C37H58O6 — CID 135247652
[4-[3-heptyl-4-[4-[4-(methoxymethoxy)cyclohexyl]cyclohexyl]phenyl]cyclohexyl]oxymethyl 2-hydroxyprop-2-enoate (PubChem CID 135247652) has the molecular formula C37H58O6 and a molecular weight of 598.87 g/mol. Its IUPAC name is [4-[3-heptyl-4-[4-[4-(methoxymethoxy)cyclohexyl]cyclohexyl]phenyl]cyclohexyl]oxymethyl 2-hydroxyprop-2-enoate.
| Compound Name | [4-[3-heptyl-4-[4-[4-(methoxymethoxy)cyclohexyl]cyclohexyl]phenyl]cyclohexyl]oxymethyl 2-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 135247652 |
| Molecular Formula | C37H58O6 |
| Molecular Weight | 598.87 g/mol |
| Exact Mass | 598.42 |
| IUPAC Name | [4-[3-heptyl-4-[4-[4-(methoxymethoxy)cyclohexyl]cyclohexyl]phenyl]cyclohexyl]oxymethyl 2-hydroxyprop-2-enoate |
| SMILES | C=C(O)C(=O)OCOC1CCC(c2ccc(C3CCC(C4CCC(OCOC)CC4)CC3)c(CCCCCCC)c2)CC1 |
| InChI | InChI=1S/C37H58O6/c1-4-5-6-7-8-9-33-24-32(30-16-21-35(22-17-30)42-26-43-37(39)27(2)38)18-23-36(33)31-12-10-28(11-13-31)29-14-19-34(20-15-29)41-25-40-3/h18,23-24,28-31,34-35,38H,2,4-17,19-22,25-26H2,1,3H3 |
| InChIKey | OWZGCRVZQJXKRY-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.87 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|