C14H2F4N2O4 — CID 14228203
2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone (PubChem CID 14228203) has the molecular formula C14H2F4N2O4 and a molecular weight of 338.17 g/mol. Its IUPAC name is 2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone.
| Compound Name | 2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 14228203 |
| Molecular Formula | C14H2F4N2O4 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
| SMILES | O=C1NC(=O)c2c(F)c(F)c3c4c(c(F)c(F)c1c24)C(=O)NC3=O |
| InChI | InChI=1S/C14H2F4N2O4/c15-7-3-1-2-5(9(7)17)13(23)20-14(24)6(2)10(18)8(16)4(1)12(22)19-11(3)21/h(H,19,21,22)(H,20,23,24) |
| InChIKey | KHJMOWRRCACPHD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|