C16H8F4N4O4 — CID 118893735
6,13-bis(aminomethyl)-2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone (PubChem CID 118893735) has the molecular formula C16H8F4N4O4 and a molecular weight of 396.26 g/mol. Its IUPAC name is 6,13-bis(aminomethyl)-2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-bis(aminomethyl)-2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 118893735 |
| Molecular Formula | C16H8F4N4O4 |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 6,13-bis(aminomethyl)-2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
| SMILES | NCN1C(=O)c2c(F)c(F)c3c4c(c(F)c(F)c(c24)C1=O)C(=O)N(CN)C3=O |
| InChI | InChI=1S/C16H8F4N4O4/c17-9-5-3-4-7(11(9)19)15(27)24(2-22)16(28)8(4)12(20)10(18)6(3)14(26)23(1-21)13(5)25/h1-2,21-22H2 |
| InChIKey | PLLFVLAKMCWNNQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|