C51H50O12 — CID 142285804
2'-methoxyspiro[1,3-dioxane-2,9'-xanthene];2'-methoxyspiro[1,3-dioxepane-2,9'-xanthene];2,9,9-trimethoxyxanthene (PubChem CID 142285804) has the molecular formula C51H50O12 and a molecular weight of 854.95 g/mol. Its IUPAC name is 2'-methoxyspiro[1,3-dioxane-2,9'-xanthene];2'-methoxyspiro[1,3-dioxepane-2,9'-xanthene];2,9,9-trimethoxyxanthene.
| Compound Name | 2'-methoxyspiro[1,3-dioxane-2,9'-xanthene];2'-methoxyspiro[1,3-dioxepane-2,9'-xanthene];2,9,9-trimethoxyxanthene |
|---|---|
| PubChem CID | 142285804 |
| Molecular Formula | C51H50O12 |
| Molecular Weight | 854.95 g/mol |
| Exact Mass | 854.33 |
| IUPAC Name | 2'-methoxyspiro[1,3-dioxane-2,9'-xanthene];2'-methoxyspiro[1,3-dioxepane-2,9'-xanthene];2,9,9-trimethoxyxanthene |
| SMILES | COc1ccc2c(c1)C(OC)(OC)c1ccccc1O2.COc1ccc2c(c1)C1(OCCCCO1)c1ccccc1O2.COc1ccc2c(c1)C1(OCCCO1)c1ccccc1O2 |
| InChI | InChI=1S/C18H18O4.C17H16O4.C16H16O4/c1-19-13-8-9-17-15(12-13)18(20-10-4-5-11-21-18)14-6-2-3-7-16(14)22-17;1-18-12-7-8-16-14(11-12)17(19-9-4-10-20-17)13-5-2-3-6-15(13)21-16;1-17-11-8-9-15-13(10-11)16(18-2,19-3)12-6-4-5-7-14(12)20-15/h2-3,6-9,12H,4-5,10-11H2,1H3;2-3,5-8,11H,4,9-10H2,1H3;4-10H,1-3H3 |
| InChIKey | YRAQPLMZCVEYDP-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.95 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|