C15H21N — CID 142288862
(2Z,4Z)-N-[(2E)-penta-2,4-dien-2-yl]-N-prop-1-en-2-ylhepta-2,4,6-trien-1-amine (PubChem CID 142288862) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (2Z,4Z)-N-[(2E)-penta-2,4-dien-2-yl]-N-prop-1-en-2-ylhepta-2,4,6-trien-1-amine.
| Compound Name | (2Z,4Z)-N-[(2E)-penta-2,4-dien-2-yl]-N-prop-1-en-2-ylhepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 142288862 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (2Z,4Z)-N-[(2E)-penta-2,4-dien-2-yl]-N-prop-1-en-2-ylhepta-2,4,6-trien-1-amine |
| SMILES | C=C/C=C\C=C/CN(C(=C)C)/C(C)=C/C=C |
| InChI | InChI=1S/C15H21N/c1-6-8-9-10-11-13-16(14(3)4)15(5)12-7-2/h6-12H,1-3,13H2,4-5H3/b9-8-,11-10-,15-12+ |
| InChIKey | NJUURBYCHMDQST-DNTDQBGHSA-N |
| XLogP | 4.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|