About ethane;4-hexa-3,4-dien-3-yl-1-methyl-2-[(Z)-prop-1-enyl]benzene
ethane;4-hexa-3,4-dien-3-yl-1-methyl-2-[(Z)-prop-1-enyl]benzene (PubChem CID 142289404) has the molecular formula C18H26
and a molecular weight of 242.41 g/mol. Its IUPAC name is ethane;4-hexa-3,4-dien-3-yl-1-methyl-2-[(Z)-prop-1-enyl]benzene.
Molecular Properties
| Compound Name | ethane;4-hexa-3,4-dien-3-yl-1-methyl-2-[(Z)-prop-1-enyl]benzene |
| PubChem CID | 142289404 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | ethane;4-hexa-3,4-dien-3-yl-1-methyl-2-[(Z)-prop-1-enyl]benzene |
| SMILES | CC.CC=C=C(CC)c1ccc(C)c(/C=C\C)c1 |
| InChI | InChI=1S/C16H20.C2H6/c1-5-8-14(7-3)16-11-10-13(4)15(12-16)9-6-2;1-2/h5-6,9-12H,7H2,1-4H3;1-2H3/b9-6-; |
| InChIKey | ASOCPWWMTJHHNQ-BORNJIKYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;4-hexa-3,4-dien-3-yl-1-methyl-2-[(Z)-prop-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-hexa-3,4-dien-3-yl-1-methyl-2-[(Z)-prop-1-enyl]benzene?
The IUPAC name of ethane;4-hexa-3,4-dien-3-yl-1-methyl-2-[(Z)-prop-1-enyl]benzene (CID 142289404) is ethane;4-hexa-3,4-dien-3-yl-1-methyl-2-[(Z)-prop-1-enyl]benzene.
What is the SMILES notation for ethane;4-hexa-3,4-dien-3-yl-1-methyl-2-[(Z)-prop-1-enyl]benzene?
The canonical SMILES for ethane;4-hexa-3,4-dien-3-yl-1-methyl-2-[(Z)-prop-1-enyl]benzene is CC.CC=C=C(CC)c1ccc(C)c(/C=C\C)c1.
What is the InChIKey of ethane;4-hexa-3,4-dien-3-yl-1-methyl-2-[(Z)-prop-1-enyl]benzene?
The InChIKey is ASOCPWWMTJHHNQ-BORNJIKYSA-N. The full InChI is InChI=1S/C16H20.C2H6/c1-5-8-14(7-3)16-11-10-13(4)15(12-16)9-6-2;1-2/h5-6,9-12H,7H2,1-4H3;1-2H3/b9-6-;.
What are the key properties of ethane;4-hexa-3,4-dien-3-yl-1-methyl-2-[(Z)-prop-1-enyl]benzene?
ethane;4-hexa-3,4-dien-3-yl-1-methyl-2-[(Z)-prop-1-enyl]benzene has a molecular weight of 242.41 g/mol, XLogP of 6.02, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-hexa-3,4-dien-3-yl-1-methyl-2-[(Z)-prop-1-enyl]benzene is sourced from PubChem (CID 142289404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).