C15H17ClO — CID 143792926
4-methyl-3-[(1Z,3E)-4-methylhexa-1,3-dienyl]benzoyl chloride (PubChem CID 143792926) has the molecular formula C15H17ClO and a molecular weight of 248.75 g/mol. Its IUPAC name is 4-methyl-3-[(1Z,3E)-4-methylhexa-1,3-dienyl]benzoyl chloride.
| Compound Name | 4-methyl-3-[(1Z,3E)-4-methylhexa-1,3-dienyl]benzoyl chloride |
|---|---|
| PubChem CID | 143792926 |
| Molecular Formula | C15H17ClO |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 4-methyl-3-[(1Z,3E)-4-methylhexa-1,3-dienyl]benzoyl chloride |
| SMILES | CC/C(C)=C/C=C\c1cc(C(=O)Cl)ccc1C |
| InChI | InChI=1S/C15H17ClO/c1-4-11(2)6-5-7-13-10-14(15(16)17)9-8-12(13)3/h5-10H,4H2,1-3H3/b7-5-,11-6+ |
| InChIKey | AOUKCNYPBVCUEG-LAVHUSFLSA-N |
| XLogP | 4.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|