C31H44N4O — CID 142291113
N-[2-(diethylamino)ethyl]-4-methyl-3-[2-[2-(methylamino)quinolin-4-yl]ethynyl]benzamide;ethane;propane (PubChem CID 142291113) has the molecular formula C31H44N4O and a molecular weight of 488.72 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-methyl-3-[2-[2-(methylamino)quinolin-4-yl]ethynyl]benzamide;ethane;propane.
| Compound Name | N-[2-(diethylamino)ethyl]-4-methyl-3-[2-[2-(methylamino)quinolin-4-yl]ethynyl]benzamide;ethane;propane |
|---|---|
| PubChem CID | 142291113 |
| Molecular Formula | C31H44N4O |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-methyl-3-[2-[2-(methylamino)quinolin-4-yl]ethynyl]benzamide;ethane;propane |
| SMILES | CC.CCC.CCN(CC)CCNC(=O)c1ccc(C)c(C#Cc2cc(NC)nc3ccccc23)c1 |
| InChI | InChI=1S/C26H30N4O.C3H8.C2H6/c1-5-30(6-2)16-15-28-26(31)22-12-11-19(3)20(17-22)13-14-21-18-25(27-4)29-24-10-8-7-9-23(21)24;1-3-2;1-2/h7-12,17-18H,5-6,15-16H2,1-4H3,(H,27,29)(H,28,31);3H2,1-2H3;1-2H3 |
| InChIKey | GZEMKYKEIOOYBO-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|