C26H30N4O — CID 142291239
N-[2-(diethylamino)ethyl]-4-methyl-3-[2-[1-(methylamino)isoquinolin-4-yl]ethynyl]benzamide (PubChem CID 142291239) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-methyl-3-[2-[1-(methylamino)isoquinolin-4-yl]ethynyl]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-methyl-3-[2-[1-(methylamino)isoquinolin-4-yl]ethynyl]benzamide |
|---|---|
| PubChem CID | 142291239 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-methyl-3-[2-[1-(methylamino)isoquinolin-4-yl]ethynyl]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(C)c(C#Cc2cnc(NC)c3ccccc23)c1 |
| InChI | InChI=1S/C26H30N4O/c1-5-30(6-2)16-15-28-26(31)21-12-11-19(3)20(17-21)13-14-22-18-29-25(27-4)24-10-8-7-9-23(22)24/h7-12,17-18H,5-6,15-16H2,1-4H3,(H,27,29)(H,28,31) |
| InChIKey | QTVBQULEWNXRCV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|