C12H16F3N5 — CID 142292803
4-N-cyclohexyl-5-(2,2,2-trifluoroethanimidoyl)pyrimidine-4,6-diamine (PubChem CID 142292803) has the molecular formula C12H16F3N5 and a molecular weight of 287.29 g/mol. Its IUPAC name is 4-N-cyclohexyl-5-(2,2,2-trifluoroethanimidoyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclohexyl-5-(2,2,2-trifluoroethanimidoyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 142292803 |
| Molecular Formula | C12H16F3N5 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 4-N-cyclohexyl-5-(2,2,2-trifluoroethanimidoyl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(/c1c(N)ncnc1NC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H16F3N5/c13-12(14,15)9(16)8-10(17)18-6-19-11(8)20-7-4-2-1-3-5-7/h6-7,16H,1-5H2,(H3,17,18,19,20)/b16-9- |
| InChIKey | IHNRQWWWPPGFGZ-SXGWCWSVSA-N |
| XLogP | 2.73 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|