C27H30N6O3S — CID 142294973
2-(4-hydroxy-3-methoxyphenyl)-N-[5-[4-[6-(2-phenylethylamino)pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 142294973) has the molecular formula C27H30N6O3S and a molecular weight of 518.64 g/mol. Its IUPAC name is 2-(4-hydroxy-3-methoxyphenyl)-N-[5-[4-[6-(2-phenylethylamino)pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(4-hydroxy-3-methoxyphenyl)-N-[5-[4-[6-(2-phenylethylamino)pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 142294973 |
| Molecular Formula | C27H30N6O3S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 2-(4-hydroxy-3-methoxyphenyl)-N-[5-[4-[6-(2-phenylethylamino)pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COc1cc(CC(=O)Nc2nnc(CCCCc3ccc(NCCc4ccccc4)nn3)s2)ccc1O |
| InChI | InChI=1S/C27H30N6O3S/c1-36-23-17-20(11-13-22(23)34)18-25(35)29-27-33-32-26(37-27)10-6-5-9-21-12-14-24(31-30-21)28-16-15-19-7-3-2-4-8-19/h2-4,7-8,11-14,17,34H,5-6,9-10,15-16,18H2,1H3,(H,28,31)(H,29,33,35) |
| InChIKey | NQEPKMQHHBKKMU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 122.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|