About CID 142296777
CID 142296777 (PubChem CID 142296777) has the molecular formula C30H19BN2O4
and a molecular weight of 482.30 g/mol.
Molecular Properties
| Compound Name | CID 142296777 |
| PubChem CID | 142296777 |
| Molecular Formula | C30H19BN2O4 |
| Molecular Weight | 482.30 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | — |
| SMILES | [B]c1cc(OC(=O)c2ccc(-c3ccccn3)cc2)cc(OC(=O)c2ccc(-c3ccccn3)cc2)c1 |
| InChI | InChI=1S/C30H19BN2O4/c31-24-17-25(36-29(34)22-11-7-20(8-12-22)27-5-1-3-15-32-27)19-26(18-24)37-30(35)23-13-9-21(10-14-23)28-6-2-4-16-33-28/h1-19H |
| InChIKey | YPTBYIYCHXRSHC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.30 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze CID 142296777 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142296777?
The IUPAC name of CID 142296777 (CID 142296777) is not available.
What is the SMILES notation for CID 142296777?
The canonical SMILES for CID 142296777 is [B]c1cc(OC(=O)c2ccc(-c3ccccn3)cc2)cc(OC(=O)c2ccc(-c3ccccn3)cc2)c1.
What is the InChIKey of CID 142296777?
The InChIKey is YPTBYIYCHXRSHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H19BN2O4/c31-24-17-25(36-29(34)22-11-7-20(8-12-22)27-5-1-3-15-32-27)19-26(18-24)37-30(35)23-13-9-21(10-14-23)28-6-2-4-16-33-28/h1-19H.
What are the key properties of CID 142296777?
CID 142296777 has a molecular weight of 482.30 g/mol, XLogP of 5.04, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142296777 is sourced from PubChem (CID 142296777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).