C23H22F2N4O3 — CID 142297147
1-fluoro-3-[(3-fluorophenyl)methyl]benzene;7-hydroxy-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-diene-6,9-dione (PubChem CID 142297147) has the molecular formula C23H22F2N4O3 and a molecular weight of 440.45 g/mol. Its IUPAC name is 1-fluoro-3-[(3-fluorophenyl)methyl]benzene;7-hydroxy-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-diene-6,9-dione.
| Compound Name | 1-fluoro-3-[(3-fluorophenyl)methyl]benzene;7-hydroxy-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-diene-6,9-dione |
|---|---|
| PubChem CID | 142297147 |
| Molecular Formula | C23H22F2N4O3 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 1-fluoro-3-[(3-fluorophenyl)methyl]benzene;7-hydroxy-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-diene-6,9-dione |
| SMILES | Fc1cccc(Cc2cccc(F)c2)c1.O=C1c2c(O)c(=O)cnn2CN2CCCCN12 |
| InChI | InChI=1S/C13H10F2.C10H12N4O3/c14-12-5-1-3-10(8-12)7-11-4-2-6-13(15)9-11;15-7-5-11-13-6-12-3-1-2-4-14(12)10(17)8(13)9(7)16/h1-6,8-9H,7H2;5,16H,1-4,6H2 |
| InChIKey | WTBXNFZRWVZXKE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |