C10H11N3O4 — CID 130255395
10,12-dihydroxy-1,3,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione (PubChem CID 130255395) has the molecular formula C10H11N3O4 and a molecular weight of 237.21 g/mol. Its IUPAC name is 10,12-dihydroxy-1,3,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione.
| Compound Name | 10,12-dihydroxy-1,3,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione |
|---|---|
| PubChem CID | 130255395 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 10,12-dihydroxy-1,3,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione |
| SMILES | O=C1c2c(O)c(=O)c(O)cn2CN2CCCN12 |
| InChI | InChI=1S/C10H11N3O4/c14-6-4-11-5-12-2-1-3-13(12)10(17)7(11)9(16)8(6)15/h4,14,16H,1-3,5H2 |
| InChIKey | QAGMBJHZICVPNM-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |